C15H22ClN5S — CID 45263102
1-butyl-2-methyl-3-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (PubChem CID 45263102) has the molecular formula C15H22ClN5S and a molecular weight of 339.90 g/mol. Its IUPAC name is 1-butyl-2-methyl-3-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 1-butyl-2-methyl-3-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45263102 |
| Molecular Formula | C15H22ClN5S |
| Molecular Weight | 339.90 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-butyl-2-methyl-3-[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| SMILES | CCCCN/C(=N\C)Nc1nnc(-c2ccccc2C)s1.Cl |
| InChI | InChI=1S/C15H21N5S.ClH/c1-4-5-10-17-14(16-3)18-15-20-19-13(21-15)12-9-7-6-8-11(12)2;/h6-9H,4-5,10H2,1-3H3,(H2,16,17,18,20);1H |
| InChIKey | BBQQJCFECOBMSX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|