About 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride
4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride (PubChem CID 45263121) has the molecular formula C8H16Cl2N4
and a molecular weight of 239.15 g/mol. Its IUPAC name is 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride |
| PubChem CID | 45263121 |
| Molecular Formula | C8H16Cl2N4 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride |
| SMILES | CNc1cncc(NC)c1CN.Cl.Cl |
| InChI | InChI=1S/C8H14N4.2ClH/c1-10-7-4-12-5-8(11-2)6(7)3-9;;/h4-5,10-11H,3,9H2,1-2H3;2*1H |
| InChIKey | RBGPLCZQGWZUFE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride?
The IUPAC name of 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride (CID 45263121) is 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride.
What is the SMILES notation for 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride?
The canonical SMILES for 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride is CNc1cncc(NC)c1CN.Cl.Cl.
What is the InChIKey of 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride?
The InChIKey is RBGPLCZQGWZUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4.2ClH/c1-10-7-4-12-5-8(11-2)6(7)3-9;;/h4-5,10-11H,3,9H2,1-2H3;2*1H.
What are the key properties of 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride?
4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 1.47, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3-N,5-N-dimethylpyridine-3,5-diamine;dihydrochloride is sourced from PubChem (CID 45263121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).