About 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride
1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride (PubChem CID 45263126) has the molecular formula C23H27ClFN3
and a molecular weight of 399.94 g/mol. Its IUPAC name is 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride |
| PubChem CID | 45263126 |
| Molecular Formula | C23H27ClFN3 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride |
| SMILES | CCCCN1CCc2c(c(-c3ccc(F)cc3)nn2Cc2ccccc2)C1.Cl |
| InChI | InChI=1S/C23H26FN3.ClH/c1-2-3-14-26-15-13-22-21(17-26)23(19-9-11-20(24)12-10-19)25-27(22)16-18-7-5-4-6-8-18;/h4-12H,2-3,13-17H2,1H3;1H |
| InChIKey | ATLPSFLHINRNPW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride?
The IUPAC name of 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride (CID 45263126) is 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride.
What is the SMILES notation for 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride?
The canonical SMILES for 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride is CCCCN1CCc2c(c(-c3ccc(F)cc3)nn2Cc2ccccc2)C1.Cl.
What is the InChIKey of 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride?
The InChIKey is ATLPSFLHINRNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26FN3.ClH/c1-2-3-14-26-15-13-22-21(17-26)23(19-9-11-20(24)12-10-19)25-27(22)16-18-7-5-4-6-8-18;/h4-12H,2-3,13-17H2,1H3;1H.
What are the key properties of 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride?
1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride has a molecular weight of 399.94 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-butyl-3-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;hydrochloride is sourced from PubChem (CID 45263126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).