About (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide
(1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide (PubChem CID 45263168) has the molecular formula C9H13Br2NO
and a molecular weight of 311.02 g/mol. Its IUPAC name is (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide.
Molecular Properties
| Compound Name | (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide |
| PubChem CID | 45263168 |
| Molecular Formula | C9H13Br2NO |
| Molecular Weight | 311.02 g/mol |
| Exact Mass | 308.94 |
| IUPAC Name | (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide |
| SMILES | Br.N[C@@H](CBr)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H12BrNO.BrH/c10-6-8(11)9(12)7-4-2-1-3-5-7;/h1-5,8-9,12H,6,11H2;1H/t8-,9-;/m0./s1 |
| InChIKey | QUSXTYRABSIQAD-OZZZDHQUSA-N |
| XLogP | 2.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.02 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide?
The IUPAC name of (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide (CID 45263168) is (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide.
What is the SMILES notation for (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide?
The canonical SMILES for (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide is Br.N[C@@H](CBr)[C@@H](O)c1ccccc1.
What is the InChIKey of (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide?
The InChIKey is QUSXTYRABSIQAD-OZZZDHQUSA-N. The full InChI is InChI=1S/C9H12BrNO.BrH/c10-6-8(11)9(12)7-4-2-1-3-5-7;/h1-5,8-9,12H,6,11H2;1H/t8-,9-;/m0./s1.
What are the key properties of (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide?
(1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide has a molecular weight of 311.02 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-2-amino-3-bromo-1-phenylpropan-1-ol;hydrobromide is sourced from PubChem (CID 45263168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).