About (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide
(1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide (PubChem CID 45263171) has the molecular formula C10H15Br2NOS
and a molecular weight of 357.11 g/mol. Its IUPAC name is (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide.
Molecular Properties
| Compound Name | (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide |
| PubChem CID | 45263171 |
| Molecular Formula | C10H15Br2NOS |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide |
| SMILES | Br.CSc1ccc([C@H](O)[C@@H](N)CBr)cc1 |
| InChI | InChI=1S/C10H14BrNOS.BrH/c1-14-8-4-2-7(3-5-8)10(13)9(12)6-11;/h2-5,9-10,13H,6,12H2,1H3;1H/t9-,10-;/m0./s1 |
| InChIKey | YHXSAXXINSEKIB-IYPAPVHQSA-N |
| XLogP | 2.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide?
The IUPAC name of (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide (CID 45263171) is (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide.
What is the SMILES notation for (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide?
The canonical SMILES for (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide is Br.CSc1ccc([C@H](O)[C@@H](N)CBr)cc1.
What is the InChIKey of (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide?
The InChIKey is YHXSAXXINSEKIB-IYPAPVHQSA-N. The full InChI is InChI=1S/C10H14BrNOS.BrH/c1-14-8-4-2-7(3-5-8)10(13)9(12)6-11;/h2-5,9-10,13H,6,12H2,1H3;1H/t9-,10-;/m0./s1.
What are the key properties of (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide?
(1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide has a molecular weight of 357.11 g/mol, XLogP of 2.74, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-2-amino-3-bromo-1-(4-methylsulfanylphenyl)propan-1-ol;hydrobromide is sourced from PubChem (CID 45263171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).