About 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride
2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride (PubChem CID 45263204) has the molecular formula C9H13ClN2O2S
and a molecular weight of 248.73 g/mol. Its IUPAC name is 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride |
| PubChem CID | 45263204 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride |
| SMILES | Cl.NC1Cc2ccc(S(N)(=O)=O)cc2C1 |
| InChI | InChI=1S/C9H12N2O2S.ClH/c10-8-3-6-1-2-9(14(11,12)13)5-7(6)4-8;/h1-2,5,8H,3-4,10H2,(H2,11,12,13);1H |
| InChIKey | BWTNITRRXJVYSN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride?
The IUPAC name of 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride (CID 45263204) is 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride.
What is the SMILES notation for 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride?
The canonical SMILES for 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride is Cl.NC1Cc2ccc(S(N)(=O)=O)cc2C1.
What is the InChIKey of 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride?
The InChIKey is BWTNITRRXJVYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S.ClH/c10-8-3-6-1-2-9(14(11,12)13)5-7(6)4-8;/h1-2,5,8H,3-4,10H2,(H2,11,12,13);1H.
What are the key properties of 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride?
2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride has a molecular weight of 248.73 g/mol, XLogP of 0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2,3-dihydro-1H-indene-5-sulfonamide;hydrochloride is sourced from PubChem (CID 45263204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).