About 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride
2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride (PubChem CID 45263213) has the molecular formula C20H32ClN3O2
and a molecular weight of 381.95 g/mol. Its IUPAC name is 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride |
| PubChem CID | 45263213 |
| Molecular Formula | C20H32ClN3O2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride |
| SMILES | CCCCCCCCc1ccc(-c2cnc(C(N)(CO)CO)[nH]2)cc1.Cl |
| InChI | InChI=1S/C20H31N3O2.ClH/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)18-13-22-19(23-18)20(21,14-24)15-25;/h9-13,24-25H,2-8,14-15,21H2,1H3,(H,22,23);1H |
| InChIKey | YUVOWUVQMVCDFY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride?
The IUPAC name of 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride (CID 45263213) is 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride?
The canonical SMILES for 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride is CCCCCCCCc1ccc(-c2cnc(C(N)(CO)CO)[nH]2)cc1.Cl.
What is the InChIKey of 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride?
The InChIKey is YUVOWUVQMVCDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O2.ClH/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)18-13-22-19(23-18)20(21,14-24)15-25;/h9-13,24-25H,2-8,14-15,21H2,1H3,(H,22,23);1H.
What are the key properties of 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride?
2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride has a molecular weight of 381.95 g/mol, XLogP of 3.54, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[5-(4-octylphenyl)-1H-imidazol-2-yl]propane-1,3-diol;hydrochloride is sourced from PubChem (CID 45263213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).