About 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride
1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 45263296) has the molecular formula C20H26ClNO2S2
and a molecular weight of 412.02 g/mol. Its IUPAC name is 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride |
| PubChem CID | 45263296 |
| Molecular Formula | C20H26ClNO2S2 |
| Molecular Weight | 412.02 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cc1ccsc1C(=CCCN1CCC(C(=O)O)CC1)c1sccc1C.Cl |
| InChI | InChI=1S/C20H25NO2S2.ClH/c1-14-7-12-24-18(14)17(19-15(2)8-13-25-19)4-3-9-21-10-5-16(6-11-21)20(22)23;/h4,7-8,12-13,16H,3,5-6,9-11H2,1-2H3,(H,22,23);1H |
| InChIKey | FJFOZETWOKQNSR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride?
The IUPAC name of 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride (CID 45263296) is 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride.
What is the SMILES notation for 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride?
The canonical SMILES for 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride is Cc1ccsc1C(=CCCN1CCC(C(=O)O)CC1)c1sccc1C.Cl.
What is the InChIKey of 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride?
The InChIKey is FJFOZETWOKQNSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2S2.ClH/c1-14-7-12-24-18(14)17(19-15(2)8-13-25-19)4-3-9-21-10-5-16(6-11-21)20(22)23;/h4,7-8,12-13,16H,3,5-6,9-11H2,1-2H3,(H,22,23);1H.
What are the key properties of 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride?
1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride has a molecular weight of 412.02 g/mol, XLogP of 5.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 45263296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).