About 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride
6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride (PubChem CID 45263523) has the molecular formula C14H16Cl2N6O
and a molecular weight of 355.23 g/mol. Its IUPAC name is 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride |
| PubChem CID | 45263523 |
| Molecular Formula | C14H16Cl2N6O |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride |
| SMILES | COc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C.Cl |
| InChI | InChI=1S/C14H15ClN6O.ClH/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21;/h4,6H,5H2,1-3H3,(H2,16,19,20);1H |
| InChIKey | MSFMHSUTLMLTNF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride?
The IUPAC name of 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride (CID 45263523) is 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride.
What is the SMILES notation for 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride?
The canonical SMILES for 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride is COc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C.Cl.
What is the InChIKey of 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride?
The InChIKey is MSFMHSUTLMLTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN6O.ClH/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21;/h4,6H,5H2,1-3H3,(H2,16,19,20);1H.
What are the key properties of 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride?
6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride has a molecular weight of 355.23 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine;hydrochloride is sourced from PubChem (CID 45263523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).