C20H19ClN4O3 — CID 45263530
4-(3-methoxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;hydrochloride (PubChem CID 45263530) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;hydrochloride.
| Compound Name | 4-(3-methoxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;hydrochloride |
|---|---|
| PubChem CID | 45263530 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-(3-methoxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;hydrochloride |
| SMILES | COc1cccc(-c2nc(N3CCOCC3)c3oc4ncccc4c3n2)c1.Cl |
| InChI | InChI=1S/C20H18N4O3.ClH/c1-25-14-5-2-4-13(12-14)18-22-16-15-6-3-7-21-20(15)27-17(16)19(23-18)24-8-10-26-11-9-24;/h2-7,12H,8-11H2,1H3;1H |
| InChIKey | ADNFEQUPFSSMHG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |