C19H34ClN3 — CID 45263553
N'-[4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylamino)butyl]butane-1,4-diamine;hydrochloride (PubChem CID 45263553) has the molecular formula C19H34ClN3 and a molecular weight of 339.96 g/mol. Its IUPAC name is N'-[4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylamino)butyl]butane-1,4-diamine;hydrochloride.
| Compound Name | N'-[4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylamino)butyl]butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 45263553 |
| Molecular Formula | C19H34ClN3 |
| Molecular Weight | 339.96 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N'-[4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylamino)butyl]butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCCCNCCCCNCC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H33N3.ClH/c20-12-3-4-13-21-14-5-6-15-22-16-18-10-7-9-17-8-1-2-11-19(17)18;/h1-2,8,11,18,21-22H,3-7,9-10,12-16,20H2;1H |
| InChIKey | VZSAVTFODUKZCZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|