About 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride
1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride (PubChem CID 45263635) has the molecular formula C15H26ClN
and a molecular weight of 255.83 g/mol. Its IUPAC name is 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride.
Molecular Properties
| Compound Name | 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride |
| PubChem CID | 45263635 |
| Molecular Formula | C15H26ClN |
| Molecular Weight | 255.83 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride |
| SMILES | CN1CCC2(CC1)C1CC3CC(C1)CC2C3.Cl |
| InChI | InChI=1S/C15H25N.ClH/c1-16-4-2-15(3-5-16)13-7-11-6-12(9-13)10-14(15)8-11;/h11-14H,2-10H2,1H3;1H |
| InChIKey | BBOONPNLVKNHKD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride?
The IUPAC name of 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride (CID 45263635) is 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride.
What is the SMILES notation for 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride?
The canonical SMILES for 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride is CN1CCC2(CC1)C1CC3CC(C1)CC2C3.Cl.
What is the InChIKey of 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride?
The InChIKey is BBOONPNLVKNHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N.ClH/c1-16-4-2-15(3-5-16)13-7-11-6-12(9-13)10-14(15)8-11;/h11-14H,2-10H2,1H3;1H.
What are the key properties of 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride?
1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride has a molecular weight of 255.83 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[adamantane-2,4'-piperidine];hydrochloride is sourced from PubChem (CID 45263635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).