C24H21ClF9N5O — CID 45263674
(3R)-3-amino-1-[3-(trifluoromethyl)-8-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 45263674) has the molecular formula C24H21ClF9N5O and a molecular weight of 601.90 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-(trifluoromethyl)-8-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-[3-(trifluoromethyl)-8-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 45263674 |
| Molecular Formula | C24H21ClF9N5O |
| Molecular Weight | 601.90 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | (3R)-3-amino-1-[3-(trifluoromethyl)-8-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1Cc1ccccc1C(F)(F)F)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H20F9N5O.ClH/c25-16-11-18(27)17(26)8-13(16)7-14(34)10-20(39)37-5-6-38-21(35-36-22(38)24(31,32)33)19(37)9-12-3-1-2-4-15(12)23(28,29)30;/h1-4,8,11,14,19H,5-7,9-10,34H2;1H/t14-,19?;/m1./s1 |
| InChIKey | GESRRLSITZLOAD-NWGPWHLASA-N |
| XLogP | 5.24 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|