C20H23ClF6N6O2 — CID 45263693
2-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]-N,N-dimethylacetamide;hydrochloride (PubChem CID 45263693) has the molecular formula C20H23ClF6N6O2 and a molecular weight of 528.89 g/mol. Its IUPAC name is 2-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]-N,N-dimethylacetamide;hydrochloride.
| Compound Name | 2-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]-N,N-dimethylacetamide;hydrochloride |
|---|---|
| PubChem CID | 45263693 |
| Molecular Formula | C20H23ClF6N6O2 |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 2-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]-N,N-dimethylacetamide;hydrochloride |
| SMILES | CN(C)C(=O)CC1c2nnc(C(F)(F)F)n2CCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F.Cl |
| InChI | InChI=1S/C20H22F6N6O2.ClH/c1-30(2)16(33)9-15-18-28-29-19(20(24,25)26)32(18)4-3-31(15)17(34)7-11(27)5-10-6-13(22)14(23)8-12(10)21;/h6,8,11,15H,3-5,7,9,27H2,1-2H3;1H/t11-,15?;/m1./s1 |
| InChIKey | NSNXYLYKGIWDIN-IXCAENJASA-N |
| XLogP | 2.46 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|