C27H36ClNO3 — CID 45263816
3-(4-phenylpiperidin-1-yl)propyl 1-(4-methoxyphenyl)cyclopentane-1-carboxylate;hydrochloride (PubChem CID 45263816) has the molecular formula C27H36ClNO3 and a molecular weight of 458.04 g/mol. Its IUPAC name is 3-(4-phenylpiperidin-1-yl)propyl 1-(4-methoxyphenyl)cyclopentane-1-carboxylate;hydrochloride.
| Compound Name | 3-(4-phenylpiperidin-1-yl)propyl 1-(4-methoxyphenyl)cyclopentane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45263816 |
| Molecular Formula | C27H36ClNO3 |
| Molecular Weight | 458.04 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 3-(4-phenylpiperidin-1-yl)propyl 1-(4-methoxyphenyl)cyclopentane-1-carboxylate;hydrochloride |
| SMILES | COc1ccc(C2(C(=O)OCCCN3CCC(c4ccccc4)CC3)CCCC2)cc1.Cl |
| InChI | InChI=1S/C27H35NO3.ClH/c1-30-25-12-10-24(11-13-25)27(16-5-6-17-27)26(29)31-21-7-18-28-19-14-23(15-20-28)22-8-3-2-4-9-22;/h2-4,8-13,23H,5-7,14-21H2,1H3;1H |
| InChIKey | HHWYEUDAFGWILH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.04 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|