About 1,4-dihydroquinazolin-2-amine;hydrobromide
1,4-dihydroquinazolin-2-amine;hydrobromide (PubChem CID 45263885) has the molecular formula C8H10BrN3
and a molecular weight of 228.09 g/mol. Its IUPAC name is 1,4-dihydroquinazolin-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 1,4-dihydroquinazolin-2-amine;hydrobromide |
| PubChem CID | 45263885 |
| Molecular Formula | C8H10BrN3 |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 1,4-dihydroquinazolin-2-amine;hydrobromide |
| SMILES | Br.NC1=NCc2ccccc2N1 |
| InChI | InChI=1S/C8H9N3.BrH/c9-8-10-5-6-3-1-2-4-7(6)11-8;/h1-4H,5H2,(H3,9,10,11);1H |
| InChIKey | RXCXYMVUYRKQAO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dihydroquinazolin-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroquinazolin-2-amine;hydrobromide?
The IUPAC name of 1,4-dihydroquinazolin-2-amine;hydrobromide (CID 45263885) is 1,4-dihydroquinazolin-2-amine;hydrobromide.
What is the SMILES notation for 1,4-dihydroquinazolin-2-amine;hydrobromide?
The canonical SMILES for 1,4-dihydroquinazolin-2-amine;hydrobromide is Br.NC1=NCc2ccccc2N1.
What is the InChIKey of 1,4-dihydroquinazolin-2-amine;hydrobromide?
The InChIKey is RXCXYMVUYRKQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.BrH/c9-8-10-5-6-3-1-2-4-7(6)11-8;/h1-4H,5H2,(H3,9,10,11);1H.
What are the key properties of 1,4-dihydroquinazolin-2-amine;hydrobromide?
1,4-dihydroquinazolin-2-amine;hydrobromide has a molecular weight of 228.09 g/mol, XLogP of 1.50, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroquinazolin-2-amine;hydrobromide is sourced from PubChem (CID 45263885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).