About 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide
8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide (PubChem CID 45263902) has the molecular formula C9H12IN3
and a molecular weight of 289.12 g/mol. Its IUPAC name is 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide.
Molecular Properties
| Compound Name | 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide |
| PubChem CID | 45263902 |
| Molecular Formula | C9H12IN3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide |
| SMILES | Cc1cccc2c1NC(N)=NC2.I |
| InChI | InChI=1S/C9H11N3.HI/c1-6-3-2-4-7-5-11-9(10)12-8(6)7;/h2-4H,5H2,1H3,(H3,10,11,12);1H |
| InChIKey | WWMZXIOGSRQYPP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide?
The IUPAC name of 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide (CID 45263902) is 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide.
What is the SMILES notation for 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide?
The canonical SMILES for 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide is Cc1cccc2c1NC(N)=NC2.I.
What is the InChIKey of 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide?
The InChIKey is WWMZXIOGSRQYPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3.HI/c1-6-3-2-4-7-5-11-9(10)12-8(6)7;/h2-4H,5H2,1H3,(H3,10,11,12);1H.
What are the key properties of 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide?
8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide has a molecular weight of 289.12 g/mol, XLogP of 1.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,4-dihydroquinazolin-2-amine;hydroiodide is sourced from PubChem (CID 45263902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).