C22H31ClN4O2S — CID 45263938
4,4-dimethyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride (PubChem CID 45263938) has the molecular formula C22H31ClN4O2S and a molecular weight of 451.04 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 4,4-dimethyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 45263938 |
| Molecular Formula | C22H31ClN4O2S |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 4,4-dimethyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride |
| SMILES | CC1(C)CC(=O)N(CCCCN2CCN(c3nccc4sccc34)CC2)C(=O)C1.Cl |
| InChI | InChI=1S/C22H30N4O2S.ClH/c1-22(2)15-19(27)26(20(28)16-22)9-4-3-8-24-10-12-25(13-11-24)21-17-6-14-29-18(17)5-7-23-21;/h5-7,14H,3-4,8-13,15-16H2,1-2H3;1H |
| InChIKey | LKONUDUCJRIXER-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|