C21H29ClN4O2S — CID 45263941
4-methyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride (PubChem CID 45263941) has the molecular formula C21H29ClN4O2S and a molecular weight of 437.01 g/mol. Its IUPAC name is 4-methyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 4-methyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 45263941 |
| Molecular Formula | C21H29ClN4O2S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-methyl-1-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]piperidine-2,6-dione;hydrochloride |
| SMILES | CC1CC(=O)N(CCCCN2CCN(c3nccc4sccc34)CC2)C(=O)C1.Cl |
| InChI | InChI=1S/C21H28N4O2S.ClH/c1-16-14-19(26)25(20(27)15-16)8-3-2-7-23-9-11-24(12-10-23)21-17-5-13-28-18(17)4-6-22-21;/h4-6,13,16H,2-3,7-12,14-15H2,1H3;1H |
| InChIKey | NBUGNKHCTJWHAE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|