C22H41Cl2N3O4S — CID 45264064
N-(5-aminopentyl)-N-(3-aminopropoxy)-2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonamide;dihydrochloride (PubChem CID 45264064) has the molecular formula C22H41Cl2N3O4S and a molecular weight of 514.56 g/mol. Its IUPAC name is N-(5-aminopentyl)-N-(3-aminopropoxy)-2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonamide;dihydrochloride.
| Compound Name | N-(5-aminopentyl)-N-(3-aminopropoxy)-2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 45264064 |
| Molecular Formula | C22H41Cl2N3O4S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | N-(5-aminopentyl)-N-(3-aminopropoxy)-2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonamide;dihydrochloride |
| SMILES | Cc1c(C)c(S(=O)(=O)N(CCCCCN)OCCCN)c(C)c2c1OC(C)(C)CC2.Cl.Cl |
| InChI | InChI=1S/C22H39N3O4S.2ClH/c1-16-17(2)21(18(3)19-10-11-22(4,5)29-20(16)19)30(26,27)25(28-15-9-13-24)14-8-6-7-12-23;;/h6-15,23-24H2,1-5H3;2*1H |
| InChIKey | UAWCXPKZNCVVPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|