C23H30ClN5O — CID 45264103
14-[2-(diethylamino)ethyl]-10-[2-(methylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride (PubChem CID 45264103) has the molecular formula C23H30ClN5O and a molecular weight of 427.98 g/mol. Its IUPAC name is 14-[2-(diethylamino)ethyl]-10-[2-(methylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride.
| Compound Name | 14-[2-(diethylamino)ethyl]-10-[2-(methylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
|---|---|
| PubChem CID | 45264103 |
| Molecular Formula | C23H30ClN5O |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 14-[2-(diethylamino)ethyl]-10-[2-(methylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
| SMILES | CCN(CC)CCn1nc2c3c(c(NCCNC)ccc31)C(=O)c1ccccc1-2.Cl |
| InChI | InChI=1S/C23H29N5O.ClH/c1-4-27(5-2)14-15-28-19-11-10-18(25-13-12-24-3)20-21(19)22(26-28)16-8-6-7-9-17(16)23(20)29;/h6-11,24-25H,4-5,12-15H2,1-3H3;1H |
| InChIKey | VKLPTNCVRGQEHN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|