About 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride
3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride (PubChem CID 45264120) has the molecular formula C23H27ClFN3O
and a molecular weight of 415.94 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride |
| PubChem CID | 45264120 |
| Molecular Formula | C23H27ClFN3O |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride |
| SMILES | Cl.Fc1ccc(-c2cc(CCCCN3CCN(c4ccccc4)CC3)on2)cc1 |
| InChI | InChI=1S/C23H26FN3O.ClH/c24-20-11-9-19(10-12-20)23-18-22(28-25-23)8-4-5-13-26-14-16-27(17-15-26)21-6-2-1-3-7-21;/h1-3,6-7,9-12,18H,4-5,8,13-17H2;1H |
| InChIKey | PVCUJAINQRZLFF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride?
The IUPAC name of 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride (CID 45264120) is 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride.
What is the SMILES notation for 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride?
The canonical SMILES for 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride is Cl.Fc1ccc(-c2cc(CCCCN3CCN(c4ccccc4)CC3)on2)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride?
The InChIKey is PVCUJAINQRZLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26FN3O.ClH/c24-20-11-9-19(10-12-20)23-18-22(28-25-23)8-4-5-13-26-14-16-27(17-15-26)21-6-2-1-3-7-21;/h1-3,6-7,9-12,18H,4-5,8,13-17H2;1H.
What are the key properties of 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride?
3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride has a molecular weight of 415.94 g/mol, XLogP of 5.05, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-5-[4-(4-phenylpiperazin-1-yl)butyl]-1,2-oxazole;hydrochloride is sourced from PubChem (CID 45264120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).