About 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide
2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide (PubChem CID 45264144) has the molecular formula C9H12BrCl2NO
and a molecular weight of 301.01 g/mol. Its IUPAC name is 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide |
| PubChem CID | 45264144 |
| Molecular Formula | C9H12BrCl2NO |
| Molecular Weight | 301.01 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide |
| SMILES | Br.Cc1c(C)c(Cl)c(Cl)c(CN)c1O |
| InChI | InChI=1S/C9H11Cl2NO.BrH/c1-4-5(2)9(13)6(3-12)8(11)7(4)10;/h13H,3,12H2,1-2H3;1H |
| InChIKey | OAIBGOXEFZXBML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.01 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide?
The IUPAC name of 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide (CID 45264144) is 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide.
What is the SMILES notation for 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide?
The canonical SMILES for 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide is Br.Cc1c(C)c(Cl)c(Cl)c(CN)c1O.
What is the InChIKey of 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide?
The InChIKey is OAIBGOXEFZXBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2NO.BrH/c1-4-5(2)9(13)6(3-12)8(11)7(4)10;/h13H,3,12H2,1-2H3;1H.
What are the key properties of 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide?
2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide has a molecular weight of 301.01 g/mol, XLogP of 3.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3,4-dichloro-5,6-dimethylphenol;hydrobromide is sourced from PubChem (CID 45264144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).