C22H30Cl6N2 — CID 45264163
N,N'-dibutyl-1,2-bis(2,6-dichlorophenyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 45264163) has the molecular formula C22H30Cl6N2 and a molecular weight of 535.21 g/mol. Its IUPAC name is N,N'-dibutyl-1,2-bis(2,6-dichlorophenyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N,N'-dibutyl-1,2-bis(2,6-dichlorophenyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 45264163 |
| Molecular Formula | C22H30Cl6N2 |
| Molecular Weight | 535.21 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | N,N'-dibutyl-1,2-bis(2,6-dichlorophenyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | CCCCNC(c1c(Cl)cccc1Cl)C(NCCCC)c1c(Cl)cccc1Cl.Cl.Cl |
| InChI | InChI=1S/C22H28Cl4N2.2ClH/c1-3-5-13-27-21(19-15(23)9-7-10-16(19)24)22(28-14-6-4-2)20-17(25)11-8-12-18(20)26;;/h7-12,21-22,27-28H,3-6,13-14H2,1-2H3;2*1H |
| InChIKey | IZGVOAYHXWDDML-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.21 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|