C34H41ClN6O3 — CID 45264184
benzyl 4-[2-[[14-[2-(diethylamino)ethyl]-8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]amino]ethyl]piperazine-1-carboxylate;hydrochloride (PubChem CID 45264184) has the molecular formula C34H41ClN6O3 and a molecular weight of 617.19 g/mol. Its IUPAC name is benzyl 4-[2-[[14-[2-(diethylamino)ethyl]-8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]amino]ethyl]piperazine-1-carboxylate;hydrochloride.
| Compound Name | benzyl 4-[2-[[14-[2-(diethylamino)ethyl]-8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]amino]ethyl]piperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45264184 |
| Molecular Formula | C34H41ClN6O3 |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | benzyl 4-[2-[[14-[2-(diethylamino)ethyl]-8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]amino]ethyl]piperazine-1-carboxylate;hydrochloride |
| SMILES | CCN(CC)CCn1nc2c3c(c(NCCN4CCN(C(=O)OCc5ccccc5)CC4)ccc31)C(=O)c1ccccc1-2.Cl |
| InChI | InChI=1S/C34H40N6O3.ClH/c1-3-37(4-2)20-23-40-29-15-14-28(30-31(29)32(36-40)26-12-8-9-13-27(26)33(30)41)35-16-17-38-18-21-39(22-19-38)34(42)43-24-25-10-6-5-7-11-25;/h5-15,35H,3-4,16-24H2,1-2H3;1H |
| InChIKey | DZAUUTNQJLBVNJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|