C13H12Cl2N6OS2 — CID 45264300
N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 45264300) has the molecular formula C13H12Cl2N6OS2 and a molecular weight of 403.32 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45264300 |
| Molecular Formula | C13H12Cl2N6OS2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(Cl)ccc2sc(NC(=O)c3csc(N=C(N)N)n3)nc12.Cl |
| InChI | InChI=1S/C13H11ClN6OS2.ClH/c1-5-6(14)2-3-8-9(5)18-13(23-8)19-10(21)7-4-22-12(17-7)20-11(15)16;/h2-4H,1H3,(H,18,19,21)(H4,15,16,17,20);1H |
| InChIKey | VZXHENXQWBHQFF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|