About 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride
2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride (PubChem CID 45264309) has the molecular formula C24H31ClN2O2
and a molecular weight of 414.98 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride |
| PubChem CID | 45264309 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCN(c2ccccc2)CC1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C24H30N2O2.ClH/c27-23(24(13-7-8-14-24)21-9-3-1-4-10-21)28-20-19-25-15-17-26(18-16-25)22-11-5-2-6-12-22;/h1-6,9-12H,7-8,13-20H2;1H |
| InChIKey | XCXUQQPWWBLTSC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
The IUPAC name of 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride (CID 45264309) is 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride.
What is the SMILES notation for 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
The canonical SMILES for 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride is Cl.O=C(OCCN1CCN(c2ccccc2)CC1)C1(c2ccccc2)CCCC1.
What is the InChIKey of 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
The InChIKey is XCXUQQPWWBLTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O2.ClH/c27-23(24(13-7-8-14-24)21-9-3-1-4-10-21)28-20-19-25-15-17-26(18-16-25)22-11-5-2-6-12-22;/h1-6,9-12H,7-8,13-20H2;1H.
What are the key properties of 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride has a molecular weight of 414.98 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylpiperazin-1-yl)ethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride is sourced from PubChem (CID 45264309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).