C19H30ClNO — CID 45264389
(2S,7R,9aR)-2-tert-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride (PubChem CID 45264389) has the molecular formula C19H30ClNO and a molecular weight of 323.91 g/mol. Its IUPAC name is (2S,7R,9aR)-2-tert-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride.
| Compound Name | (2S,7R,9aR)-2-tert-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 45264389 |
| Molecular Formula | C19H30ClNO |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2S,7R,9aR)-2-tert-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
| SMILES | CC(C)(C)[C@]1(O)CCN2C[C@@H](c3ccccc3)CC[C@@H]2C1.Cl |
| InChI | InChI=1S/C19H29NO.ClH/c1-18(2,3)19(21)11-12-20-14-16(9-10-17(20)13-19)15-7-5-4-6-8-15;/h4-8,16-17,21H,9-14H2,1-3H3;1H/t16-,17+,19-;/m0./s1 |
| InChIKey | CFWHZWWUZKNJSG-VENMBWNLSA-N |
| XLogP | 4.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |