About N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride
N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride (PubChem CID 45264434) has the molecular formula C8H9Cl3N2
and a molecular weight of 239.53 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride |
| PubChem CID | 45264434 |
| Molecular Formula | C8H9Cl3N2 |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride |
| SMILES | C/N=C/Nc1c(Cl)cccc1Cl.Cl |
| InChI | InChI=1S/C8H8Cl2N2.ClH/c1-11-5-12-8-6(9)3-2-4-7(8)10;/h2-5H,1H3,(H,11,12);1H |
| InChIKey | ILBDBQHDLRQIBS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride?
The IUPAC name of N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride (CID 45264434) is N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride.
What is the SMILES notation for N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride?
The canonical SMILES for N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride is C/N=C/Nc1c(Cl)cccc1Cl.Cl.
What is the InChIKey of N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride?
The InChIKey is ILBDBQHDLRQIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2.ClH/c1-11-5-12-8-6(9)3-2-4-7(8)10;/h2-5H,1H3,(H,11,12);1H.
What are the key properties of N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride?
N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride has a molecular weight of 239.53 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-N'-methylmethanimidamide;hydrochloride is sourced from PubChem (CID 45264434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).