About 7H-purine-6,8-diamine;dihydrochloride
7H-purine-6,8-diamine;dihydrochloride (PubChem CID 45264504) has the molecular formula C5H8Cl2N6
and a molecular weight of 223.07 g/mol. Its IUPAC name is 7H-purine-6,8-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 7H-purine-6,8-diamine;dihydrochloride |
| PubChem CID | 45264504 |
| Molecular Formula | C5H8Cl2N6 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 7H-purine-6,8-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C5H6N6.2ClH/c6-3-2-4(9-1-8-3)11-5(7)10-2;;/h1H,(H5,6,7,8,9,10,11);2*1H |
| InChIKey | RLDHAURDRDYWSA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7H-purine-6,8-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine-6,8-diamine;dihydrochloride?
The IUPAC name of 7H-purine-6,8-diamine;dihydrochloride (CID 45264504) is 7H-purine-6,8-diamine;dihydrochloride.
What is the SMILES notation for 7H-purine-6,8-diamine;dihydrochloride?
The canonical SMILES for 7H-purine-6,8-diamine;dihydrochloride is Cl.Cl.Nc1nc2ncnc(N)c2[nH]1.
What is the InChIKey of 7H-purine-6,8-diamine;dihydrochloride?
The InChIKey is RLDHAURDRDYWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6.2ClH/c6-3-2-4(9-1-8-3)11-5(7)10-2;;/h1H,(H5,6,7,8,9,10,11);2*1H.
What are the key properties of 7H-purine-6,8-diamine;dihydrochloride?
7H-purine-6,8-diamine;dihydrochloride has a molecular weight of 223.07 g/mol, XLogP of 0.36, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-6,8-diamine;dihydrochloride is sourced from PubChem (CID 45264504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).