C21H26ClNO — CID 45264531
(4aR,10bR)-3-[(4-methoxyphenyl)methyl]-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride (PubChem CID 45264531) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is (4aR,10bR)-3-[(4-methoxyphenyl)methyl]-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride.
| Compound Name | (4aR,10bR)-3-[(4-methoxyphenyl)methyl]-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 45264531 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (4aR,10bR)-3-[(4-methoxyphenyl)methyl]-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride |
| SMILES | COc1ccc(CN2CC[C@H]3c4ccccc4CC[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C21H25NO.ClH/c1-23-19-10-6-16(7-11-19)14-22-13-12-21-18(15-22)9-8-17-4-2-3-5-20(17)21;/h2-7,10-11,18,21H,8-9,12-15H2,1H3;1H/t18-,21+;/m0./s1 |
| InChIKey | HFIROZFMCNYVTB-OZYANKIXSA-N |
| XLogP | 4.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |