About (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride
(3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride (PubChem CID 45264532) has the molecular formula C13H15Br2Cl2N3O
and a molecular weight of 460.00 g/mol. Its IUPAC name is (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride.
Molecular Properties
| Compound Name | (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride |
| PubChem CID | 45264532 |
| Molecular Formula | C13H15Br2Cl2N3O |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 456.90 |
| IUPAC Name | (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](Cc1cnc[nH]1)C(=O)Cc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C13H13Br2N3O.2ClH/c14-10-2-1-8(3-11(10)15)4-13(19)12(16)5-9-6-17-7-18-9;;/h1-3,6-7,12H,4-5,16H2,(H,17,18);2*1H/t12-;;/m0../s1 |
| InChIKey | JUJRRJCCROPYBT-LTCKWSDVSA-N |
| XLogP | 3.46 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride?
The IUPAC name of (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride (CID 45264532) is (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride.
What is the SMILES notation for (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride?
The canonical SMILES for (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride is Cl.Cl.N[C@@H](Cc1cnc[nH]1)C(=O)Cc1ccc(Br)c(Br)c1.
What is the InChIKey of (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride?
The InChIKey is JUJRRJCCROPYBT-LTCKWSDVSA-N. The full InChI is InChI=1S/C13H13Br2N3O.2ClH/c14-10-2-1-8(3-11(10)15)4-13(19)12(16)5-9-6-17-7-18-9;;/h1-3,6-7,12H,4-5,16H2,(H,17,18);2*1H/t12-;;/m0../s1.
What are the key properties of (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride?
(3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride has a molecular weight of 460.00 g/mol, XLogP of 3.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-1-(3,4-dibromophenyl)-4-(1H-imidazol-5-yl)butan-2-one;dihydrochloride is sourced from PubChem (CID 45264532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).