C13H27Cl2N9O3 — CID 45264621
(3S)-3-amino-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide;dihydrochloride (PubChem CID 45264621) has the molecular formula C13H27Cl2N9O3 and a molecular weight of 428.33 g/mol. Its IUPAC name is (3S)-3-amino-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide;dihydrochloride.
| Compound Name | (3S)-3-amino-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide;dihydrochloride |
|---|---|
| PubChem CID | 45264621 |
| Molecular Formula | C13H27Cl2N9O3 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (3S)-3-amino-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide;dihydrochloride |
| SMILES | CN(C(=O)C[C@@H](N)CCCN=C(N)N)C1CN=C(NC(N)=O)NC1=O.Cl.Cl |
| InChI | InChI=1S/C13H25N9O3.2ClH/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16;;/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25);2*1H/t7-,8?;;/m0../s1 |
| InChIKey | NJSFCNNTPMLHMJ-LYJMGTGMSA-N |
| XLogP | -2.42 |
| TPSA | 207.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|