About 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide
4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide (PubChem CID 45264751) has the molecular formula C17H23BrN2O2
and a molecular weight of 367.29 g/mol. Its IUPAC name is 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide.
Molecular Properties
| Compound Name | 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide |
| PubChem CID | 45264751 |
| Molecular Formula | C17H23BrN2O2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide |
| SMILES | Br.O=c1[nH]oc(C2CCNCC2)c1CCCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O2.BrH/c20-17-15(8-4-7-13-5-2-1-3-6-13)16(21-19-17)14-9-11-18-12-10-14;/h1-3,5-6,14,18H,4,7-12H2,(H,19,20);1H |
| InChIKey | SRRFESYYZVZPBU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
The IUPAC name of 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide (CID 45264751) is 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide.
What is the SMILES notation for 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
The canonical SMILES for 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide is Br.O=c1[nH]oc(C2CCNCC2)c1CCCc1ccccc1.
What is the InChIKey of 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
The InChIKey is SRRFESYYZVZPBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2.BrH/c20-17-15(8-4-7-13-5-2-1-3-6-13)16(21-19-17)14-9-11-18-12-10-14;/h1-3,5-6,14,18H,4,7-12H2,(H,19,20);1H.
What are the key properties of 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide has a molecular weight of 367.29 g/mol, XLogP of 3.19, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenylpropyl)-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide is sourced from PubChem (CID 45264751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).