About methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride
methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride (PubChem CID 45264773) has the molecular formula C20H25ClN2O2
and a molecular weight of 360.88 g/mol. Its IUPAC name is methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride |
| PubChem CID | 45264773 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CCN1Cc1ccccc1.Cl |
| InChI | InChI=1S/C20H24N2O2.ClH/c1-24-20(23)19-16-21(14-17-8-4-2-5-9-17)12-13-22(19)15-18-10-6-3-7-11-18;/h2-11,19H,12-16H2,1H3;1H |
| InChIKey | ARWFTCCELMXLDY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride?
The IUPAC name of methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride (CID 45264773) is methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride is COC(=O)C1CN(Cc2ccccc2)CCN1Cc1ccccc1.Cl.
What is the InChIKey of methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride?
The InChIKey is ARWFTCCELMXLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2.ClH/c1-24-20(23)19-16-21(14-17-8-4-2-5-9-17)12-13-22(19)15-18-10-6-3-7-11-18;/h2-11,19H,12-16H2,1H3;1H.
What are the key properties of methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride?
methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride has a molecular weight of 360.88 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,4-dibenzylpiperazine-2-carboxylate;hydrochloride is sourced from PubChem (CID 45264773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).