About N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride (PubChem CID 45264929) has the molecular formula C16H23ClN2O
and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride |
| PubChem CID | 45264929 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride |
| SMILES | Cc1cccc(C(=O)N[C@@H]2CN3CCC2CC3)c1C.Cl |
| InChI | InChI=1S/C16H22N2O.ClH/c1-11-4-3-5-14(12(11)2)16(19)17-15-10-18-8-6-13(15)7-9-18;/h3-5,13,15H,6-10H2,1-2H3,(H,17,19);1H/t15-;/m1./s1 |
| InChIKey | OQXPMTFTFDACAG-XFULWGLBSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride?
The IUPAC name of N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride (CID 45264929) is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride.
What is the SMILES notation for N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride?
The canonical SMILES for N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride is Cc1cccc(C(=O)N[C@@H]2CN3CCC2CC3)c1C.Cl.
What is the InChIKey of N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride?
The InChIKey is OQXPMTFTFDACAG-XFULWGLBSA-N. The full InChI is InChI=1S/C16H22N2O.ClH/c1-11-4-3-5-14(12(11)2)16(19)17-15-10-18-8-6-13(15)7-9-18;/h3-5,13,15H,6-10H2,1-2H3,(H,17,19);1H/t15-;/m1./s1.
What are the key properties of N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride?
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride has a molecular weight of 294.83 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dimethylbenzamide;hydrochloride is sourced from PubChem (CID 45264929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).