About 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride
1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride (PubChem CID 45264986) has the molecular formula C18H20ClN3O
and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride |
| PubChem CID | 45264986 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cccc(-c2cccc(NC3=NCCN3)c2C)c1.Cl |
| InChI | InChI=1S/C18H19N3O.ClH/c1-12-16(15-6-3-5-14(11-15)13(2)22)7-4-8-17(12)21-18-19-9-10-20-18;/h3-8,11H,9-10H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | AZQGIDYWQSGYHQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride?
The IUPAC name of 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride (CID 45264986) is 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride.
What is the SMILES notation for 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride?
The canonical SMILES for 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride is CC(=O)c1cccc(-c2cccc(NC3=NCCN3)c2C)c1.Cl.
What is the InChIKey of 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride?
The InChIKey is AZQGIDYWQSGYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O.ClH/c1-12-16(15-6-3-5-14(11-15)13(2)22)7-4-8-17(12)21-18-19-9-10-20-18;/h3-8,11H,9-10H2,1-2H3,(H2,19,20,21);1H.
What are the key properties of 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride?
1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride has a molecular weight of 329.83 g/mol, XLogP of 3.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)-2-methylphenyl]phenyl]ethanone;hydrochloride is sourced from PubChem (CID 45264986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).