C29H36ClN3O2 — CID 45264998
(2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)acetyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 45264998) has the molecular formula C29H36ClN3O2 and a molecular weight of 494.08 g/mol. Its IUPAC name is (2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)acetyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)acetyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45264998 |
| Molecular Formula | C29H36ClN3O2 |
| Molecular Weight | 494.08 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)acetyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(CNC(=O)[C@@H]2CCCN2C(=O)CC2c3ccccc3C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C29H35N3O2.ClH/c30-23-15-11-20(12-16-23)19-31-29(34)27-10-5-17-32(27)28(33)18-26-24-8-3-1-6-21(24)13-14-22-7-2-4-9-25(22)26;/h1-4,6-9,13-14,20,23,26-27H,5,10-12,15-19,30H2,(H,31,34);1H/t20?,23?,27-;/m0./s1 |
| InChIKey | MULQSHRYOISWOL-QPNGRYJLSA-N |
| XLogP | 4.74 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.08 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|