About N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride
N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride (PubChem CID 45265038) has the molecular formula C14H25ClFN3
and a molecular weight of 289.83 g/mol. Its IUPAC name is N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride |
| PubChem CID | 45265038 |
| Molecular Formula | C14H25ClFN3 |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCCCNCCCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H24FN3.ClH/c15-14-6-4-13(5-7-14)12-18-11-3-10-17-9-2-1-8-16;/h4-7,17-18H,1-3,8-12,16H2;1H |
| InChIKey | CSDIYIGXCKLXDM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride?
The IUPAC name of N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride (CID 45265038) is N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride.
What is the SMILES notation for N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride?
The canonical SMILES for N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride is Cl.NCCCCNCCCNCc1ccc(F)cc1.
What is the InChIKey of N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride?
The InChIKey is CSDIYIGXCKLXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24FN3.ClH/c15-14-6-4-13(5-7-14)12-18-11-3-10-17-9-2-1-8-16;/h4-7,17-18H,1-3,8-12,16H2;1H.
What are the key properties of N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride?
N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride has a molecular weight of 289.83 g/mol, XLogP of 2.06, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[(4-fluorophenyl)methylamino]propyl]butane-1,4-diamine;hydrochloride is sourced from PubChem (CID 45265038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).