About (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride
(E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride (PubChem CID 45265153) has the molecular formula C18H38ClNO
and a molecular weight of 319.96 g/mol. Its IUPAC name is (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride |
| PubChem CID | 45265153 |
| Molecular Formula | C18H38ClNO |
| Molecular Weight | 319.96 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride |
| SMILES | CCCCCCCC/C=C/CCCCCC[C@H](N)CO.Cl |
| InChI | InChI=1S/C18H37NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(19)17-20;/h9-10,18,20H,2-8,11-17,19H2,1H3;1H/b10-9+;/t18-;/m0./s1 |
| InChIKey | MVUXXMXVIMBKCJ-RMDSBFCHSA-N |
| XLogP | 5.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride?
The IUPAC name of (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride (CID 45265153) is (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride.
What is the SMILES notation for (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride?
The canonical SMILES for (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride is CCCCCCCC/C=C/CCCCCC[C@H](N)CO.Cl.
What is the InChIKey of (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride?
The InChIKey is MVUXXMXVIMBKCJ-RMDSBFCHSA-N. The full InChI is InChI=1S/C18H37NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(19)17-20;/h9-10,18,20H,2-8,11-17,19H2,1H3;1H/b10-9+;/t18-;/m0./s1.
What are the key properties of (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride?
(E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride has a molecular weight of 319.96 g/mol, XLogP of 5.38, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-2-aminooctadec-9-en-1-ol;hydrochloride is sourced from PubChem (CID 45265153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).