About 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride
2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride (PubChem CID 45265236) has the molecular formula C8H11ClN6S
and a molecular weight of 258.74 g/mol. Its IUPAC name is 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride |
| PubChem CID | 45265236 |
| Molecular Formula | C8H11ClN6S |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cc1nc2sccn2c1/C=N/N=C(N)N.Cl |
| InChI | InChI=1S/C8H10N6S.ClH/c1-5-6(4-11-13-7(9)10)14-2-3-15-8(14)12-5;/h2-4H,1H3,(H4,9,10,13);1H/b11-4+; |
| InChIKey | NHLSANFXNRCFAB-SODSUQDMSA-N |
| XLogP | 0.73 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride?
The IUPAC name of 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride (CID 45265236) is 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride.
What is the SMILES notation for 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride?
The canonical SMILES for 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride is Cc1nc2sccn2c1/C=N/N=C(N)N.Cl.
What is the InChIKey of 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride?
The InChIKey is NHLSANFXNRCFAB-SODSUQDMSA-N. The full InChI is InChI=1S/C8H10N6S.ClH/c1-5-6(4-11-13-7(9)10)14-2-3-15-8(14)12-5;/h2-4H,1H3,(H4,9,10,13);1H/b11-4+;.
What are the key properties of 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride?
2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride has a molecular weight of 258.74 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine;hydrochloride is sourced from PubChem (CID 45265236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).