C25H30ClN3O7 — CID 45265272
3-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-3-yl]-6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride (PubChem CID 45265272) has the molecular formula C25H30ClN3O7 and a molecular weight of 519.98 g/mol. Its IUPAC name is 3-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-3-yl]-6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride.
| Compound Name | 3-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-3-yl]-6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 45265272 |
| Molecular Formula | C25H30ClN3O7 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 3-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-3-yl]-6,7-dimethoxy-1H-quinazoline-2,4-dione;hydrochloride |
| SMILES | COc1cc2[nH]c(=O)n(C3CCCN(CCCOc4ccc5c(c4)OCO5)C3)c(=O)c2cc1OC.Cl |
| InChI | InChI=1S/C25H29N3O7.ClH/c1-31-21-12-18-19(13-22(21)32-2)26-25(30)28(24(18)29)16-5-3-8-27(14-16)9-4-10-33-17-6-7-20-23(11-17)35-15-34-20;/h6-7,11-13,16H,3-5,8-10,14-15H2,1-2H3,(H,26,30);1H |
| InChIKey | JSPTZCNVCBVARY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|