About (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride
(2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride (PubChem CID 45265280) has the molecular formula C13H22ClNO
and a molecular weight of 243.78 g/mol. Its IUPAC name is (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride |
| PubChem CID | 45265280 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride |
| SMILES | CC(C)(C)[C@H](O)[C@@H](CN)c1ccccc1.Cl |
| InChI | InChI=1S/C13H21NO.ClH/c1-13(2,3)12(15)11(9-14)10-7-5-4-6-8-10;/h4-8,11-12,15H,9,14H2,1-3H3;1H/t11-,12+;/m0./s1 |
| InChIKey | HBOXPGCKZVUQOF-ZVWHLABXSA-N |
| XLogP | 2.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride?
The IUPAC name of (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride (CID 45265280) is (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride.
What is the SMILES notation for (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride?
The canonical SMILES for (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride is CC(C)(C)[C@H](O)[C@@H](CN)c1ccccc1.Cl.
What is the InChIKey of (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride?
The InChIKey is HBOXPGCKZVUQOF-ZVWHLABXSA-N. The full InChI is InChI=1S/C13H21NO.ClH/c1-13(2,3)12(15)11(9-14)10-7-5-4-6-8-10;/h4-8,11-12,15H,9,14H2,1-3H3;1H/t11-,12+;/m0./s1.
What are the key properties of (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride?
(2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride has a molecular weight of 243.78 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1-amino-4,4-dimethyl-2-phenylpentan-3-ol;hydrochloride is sourced from PubChem (CID 45265280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).