About 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride
5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride (PubChem CID 45265282) has the molecular formula C24H27ClN2O2
and a molecular weight of 410.95 g/mol. Its IUPAC name is 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride |
| PubChem CID | 45265282 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride |
| SMILES | CC(C)(C)c1nccn1CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.Cl |
| InChI | InChI=1S/C24H26N2O2.ClH/c1-23(2,3)21-25-14-15-26(21)17-20-16-24(22(27)28-20,18-10-6-4-7-11-18)19-12-8-5-9-13-19;/h4-15,20H,16-17H2,1-3H3;1H |
| InChIKey | ZPCPBGSMLOZKTH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The IUPAC name of 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride (CID 45265282) is 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride.
What is the SMILES notation for 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The canonical SMILES for 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride is CC(C)(C)c1nccn1CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.Cl.
What is the InChIKey of 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The InChIKey is ZPCPBGSMLOZKTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2.ClH/c1-23(2,3)21-25-14-15-26(21)17-20-16-24(22(27)28-20,18-10-6-4-7-11-18)19-12-8-5-9-13-19;/h4-15,20H,16-17H2,1-3H3;1H.
What are the key properties of 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride has a molecular weight of 410.95 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-tert-butylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride is sourced from PubChem (CID 45265282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).