About 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride
8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride (PubChem CID 45265367) has the molecular formula C18H17Cl2FN2
and a molecular weight of 351.25 g/mol. Its IUPAC name is 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride.
Molecular Properties
| Compound Name | 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
| PubChem CID | 45265367 |
| Molecular Formula | C18H17Cl2FN2 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
| SMILES | CN1CCc2c(c3cc(Cl)ccc3n2-c2ccc(F)cc2)C1.Cl |
| InChI | InChI=1S/C18H16ClFN2.ClH/c1-21-9-8-18-16(11-21)15-10-12(19)2-7-17(15)22(18)14-5-3-13(20)4-6-14;/h2-7,10H,8-9,11H2,1H3;1H |
| InChIKey | VXRJNPFENOWXAK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride?
The IUPAC name of 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride (CID 45265367) is 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride.
What is the SMILES notation for 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride?
The canonical SMILES for 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride is CN1CCc2c(c3cc(Cl)ccc3n2-c2ccc(F)cc2)C1.Cl.
What is the InChIKey of 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride?
The InChIKey is VXRJNPFENOWXAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClFN2.ClH/c1-21-9-8-18-16(11-21)15-10-12(19)2-7-17(15)22(18)14-5-3-13(20)4-6-14;/h2-7,10H,8-9,11H2,1H3;1H.
What are the key properties of 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride?
8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride has a molecular weight of 351.25 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride is sourced from PubChem (CID 45265367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).