About N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride
N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride (PubChem CID 45265420) has the molecular formula C23H29ClN4
and a molecular weight of 396.97 g/mol. Its IUPAC name is N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride |
| PubChem CID | 45265420 |
| Molecular Formula | C23H29ClN4 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride |
| SMILES | CN(CCCCCNc1ccc(-c2ccccc2)nn1)Cc1ccccc1.Cl |
| InChI | InChI=1S/C23H28N4.ClH/c1-27(19-20-11-5-2-6-12-20)18-10-4-9-17-24-23-16-15-22(25-26-23)21-13-7-3-8-14-21;/h2-3,5-8,11-16H,4,9-10,17-19H2,1H3,(H,24,26);1H |
| InChIKey | FATRFAFFOORVNP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride?
The IUPAC name of N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride (CID 45265420) is N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride.
What is the SMILES notation for N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride?
The canonical SMILES for N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride is CN(CCCCCNc1ccc(-c2ccccc2)nn1)Cc1ccccc1.Cl.
What is the InChIKey of N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride?
The InChIKey is FATRFAFFOORVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4.ClH/c1-27(19-20-11-5-2-6-12-20)18-10-4-9-17-24-23-16-15-22(25-26-23)21-13-7-3-8-14-21;/h2-3,5-8,11-16H,4,9-10,17-19H2,1H3,(H,24,26);1H.
What are the key properties of N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride?
N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride has a molecular weight of 396.97 g/mol, XLogP of 5.28, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-methyl-N-(6-phenylpyridazin-3-yl)pentane-1,5-diamine;hydrochloride is sourced from PubChem (CID 45265420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).