C17H23ClN4 — CID 45265478
N-[(1-ethylpyrrolidin-2-yl)methyl]-6-phenylpyridazin-3-amine;hydrochloride (PubChem CID 45265478) has the molecular formula C17H23ClN4 and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-6-phenylpyridazin-3-amine;hydrochloride.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-6-phenylpyridazin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 45265478 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-6-phenylpyridazin-3-amine;hydrochloride |
| SMILES | CCN1CCCC1CNc1ccc(-c2ccccc2)nn1.Cl |
| InChI | InChI=1S/C17H22N4.ClH/c1-2-21-12-6-9-15(21)13-18-17-11-10-16(19-20-17)14-7-4-3-5-8-14;/h3-5,7-8,10-11,15H,2,6,9,12-13H2,1H3,(H,18,20);1H |
| InChIKey | LADHVXKJEVVHCX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |