About 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride
2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (PubChem CID 45265550) has the molecular formula C9H11ClN6S
and a molecular weight of 270.75 g/mol. Its IUPAC name is 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| PubChem CID | 45265550 |
| Molecular Formula | C9H11ClN6S |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nnc(-c2ccccc2N)s1 |
| InChI | InChI=1S/C9H10N6S.ClH/c10-6-4-2-1-3-5(6)7-14-15-9(16-7)13-8(11)12;/h1-4H,10H2,(H4,11,12,13,15);1H |
| InChIKey | SBAJSRMHEVNHDE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
The IUPAC name of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (CID 45265550) is 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
What is the SMILES notation for 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
The canonical SMILES for 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride is Cl.NC(N)=Nc1nnc(-c2ccccc2N)s1.
What is the InChIKey of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
The InChIKey is SBAJSRMHEVNHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6S.ClH/c10-6-4-2-1-3-5(6)7-14-15-9(16-7)13-8(11)12;/h1-4H,10H2,(H4,11,12,13,15);1H.
What are the key properties of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride has a molecular weight of 270.75 g/mol, XLogP of 1.11, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride is sourced from PubChem (CID 45265550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).