About [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride
[3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride (PubChem CID 45265574) has the molecular formula C17H23ClN2O2
and a molecular weight of 322.84 g/mol. Its IUPAC name is [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride |
| PubChem CID | 45265574 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride |
| SMILES | C#CCN(C)C1CCc2cccc(OC(=O)N(C)CC)c21.Cl |
| InChI | InChI=1S/C17H22N2O2.ClH/c1-5-12-19(4)14-11-10-13-8-7-9-15(16(13)14)21-17(20)18(3)6-2;/h1,7-9,14H,6,10-12H2,2-4H3;1H |
| InChIKey | GMBDCYHMAUQSQX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The IUPAC name of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride (CID 45265574) is [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride.
What is the SMILES notation for [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The canonical SMILES for [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride is C#CCN(C)C1CCc2cccc(OC(=O)N(C)CC)c21.Cl.
What is the InChIKey of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The InChIKey is GMBDCYHMAUQSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2.ClH/c1-5-12-19(4)14-11-10-13-8-7-9-15(16(13)14)21-17(20)18(3)6-2;/h1,7-9,14H,6,10-12H2,2-4H3;1H.
What are the key properties of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
[3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride has a molecular weight of 322.84 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate;hydrochloride is sourced from PubChem (CID 45265574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).