About 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride
2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride (PubChem CID 45265742) has the molecular formula C13H12ClN5S
and a molecular weight of 305.79 g/mol. Its IUPAC name is 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride |
| PubChem CID | 45265742 |
| Molecular Formula | C13H12ClN5S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nnc(-c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C13H11N5S.ClH/c14-12(15)16-13-18-17-11(19-13)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H4,14,15,16,18);1H |
| InChIKey | IMZKXLVAQIDFOE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride?
The IUPAC name of 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride (CID 45265742) is 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride.
What is the SMILES notation for 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride?
The canonical SMILES for 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride is Cl.NC(N)=Nc1nnc(-c2cccc3ccccc23)s1.
What is the InChIKey of 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride?
The InChIKey is IMZKXLVAQIDFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5S.ClH/c14-12(15)16-13-18-17-11(19-13)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H4,14,15,16,18);1H.
What are the key properties of 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride?
2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride has a molecular weight of 305.79 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)guanidine;hydrochloride is sourced from PubChem (CID 45265742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).